About benzyl 2-[3-oxo-1-[4-(trifluoromethoxy)benzoyl]-2,5-dihydro-1,4-benzodiazepin-4-yl]acetate
benzyl 2-[3-oxo-1-[4-(trifluoromethoxy)benzoyl]-2,5-dihydro-1,4-benzodiazepin-4-yl]acetate (PubChem CID 58984790) has the molecular formula C26H21F3N2O5
and a molecular weight of 498.46 g/mol. Its IUPAC name is benzyl 2-[3-oxo-1-[4-(trifluoromethoxy)benzoyl]-2,5-dihydro-1,4-benzodiazepin-4-yl]acetate.
Molecular Properties
| Compound Name | benzyl 2-[3-oxo-1-[4-(trifluoromethoxy)benzoyl]-2,5-dihydro-1,4-benzodiazepin-4-yl]acetate |
| PubChem CID | 58984790 |
| Molecular Formula | C26H21F3N2O5 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | benzyl 2-[3-oxo-1-[4-(trifluoromethoxy)benzoyl]-2,5-dihydro-1,4-benzodiazepin-4-yl]acetate |
| SMILES | O=C(CN1Cc2ccccc2N(C(=O)c2ccc(OC(F)(F)F)cc2)CC1=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H21F3N2O5/c27-26(28,29)36-21-12-10-19(11-13-21)25(34)31-15-23(32)30(14-20-8-4-5-9-22(20)31)16-24(33)35-17-18-6-2-1-3-7-18/h1-13H,14-17H2 |
| InChIKey | HEBLCPZJQRMGQN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 2-[3-oxo-1-[4-(trifluoromethoxy)benzoyl]-2,5-dihydro-1,4-benzodiazepin-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[3-oxo-1-[4-(trifluoromethoxy)benzoyl]-2,5-dihydro-1,4-benzodiazepin-4-yl]acetate?
The IUPAC name of benzyl 2-[3-oxo-1-[4-(trifluoromethoxy)benzoyl]-2,5-dihydro-1,4-benzodiazepin-4-yl]acetate (CID 58984790) is benzyl 2-[3-oxo-1-[4-(trifluoromethoxy)benzoyl]-2,5-dihydro-1,4-benzodiazepin-4-yl]acetate.
What is the SMILES notation for benzyl 2-[3-oxo-1-[4-(trifluoromethoxy)benzoyl]-2,5-dihydro-1,4-benzodiazepin-4-yl]acetate?
The canonical SMILES for benzyl 2-[3-oxo-1-[4-(trifluoromethoxy)benzoyl]-2,5-dihydro-1,4-benzodiazepin-4-yl]acetate is O=C(CN1Cc2ccccc2N(C(=O)c2ccc(OC(F)(F)F)cc2)CC1=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-[3-oxo-1-[4-(trifluoromethoxy)benzoyl]-2,5-dihydro-1,4-benzodiazepin-4-yl]acetate?
The InChIKey is HEBLCPZJQRMGQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21F3N2O5/c27-26(28,29)36-21-12-10-19(11-13-21)25(34)31-15-23(32)30(14-20-8-4-5-9-22(20)31)16-24(33)35-17-18-6-2-1-3-7-18/h1-13H,14-17H2.
What are the key properties of benzyl 2-[3-oxo-1-[4-(trifluoromethoxy)benzoyl]-2,5-dihydro-1,4-benzodiazepin-4-yl]acetate?
benzyl 2-[3-oxo-1-[4-(trifluoromethoxy)benzoyl]-2,5-dihydro-1,4-benzodiazepin-4-yl]acetate has a molecular weight of 498.46 g/mol, XLogP of 4.32, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[3-oxo-1-[4-(trifluoromethoxy)benzoyl]-2,5-dihydro-1,4-benzodiazepin-4-yl]acetate is sourced from PubChem (CID 58984790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).