About methyl 5-[[(2S,4S)-4-methoxy-1-methylpyrrolidine-2-carbonyl]amino]-4-oxopentanoate
methyl 5-[[(2S,4S)-4-methoxy-1-methylpyrrolidine-2-carbonyl]amino]-4-oxopentanoate (PubChem CID 58984947) has the molecular formula C13H22N2O5
and a molecular weight of 286.33 g/mol. Its IUPAC name is methyl 5-[[(2S,4S)-4-methoxy-1-methylpyrrolidine-2-carbonyl]amino]-4-oxopentanoate.
Molecular Properties
| Compound Name | methyl 5-[[(2S,4S)-4-methoxy-1-methylpyrrolidine-2-carbonyl]amino]-4-oxopentanoate |
| PubChem CID | 58984947 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | methyl 5-[[(2S,4S)-4-methoxy-1-methylpyrrolidine-2-carbonyl]amino]-4-oxopentanoate |
| SMILES | COC(=O)CCC(=O)CNC(=O)[C@@H]1C[C@H](OC)CN1C |
| InChI | InChI=1S/C13H22N2O5/c1-15-8-10(19-2)6-11(15)13(18)14-7-9(16)4-5-12(17)20-3/h10-11H,4-8H2,1-3H3,(H,14,18)/t10-,11-/m0/s1 |
| InChIKey | GTHARAWAGZTILC-QWRGUYRKSA-N |
| XLogP | -0.66 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-[[(2S,4S)-4-methoxy-1-methylpyrrolidine-2-carbonyl]amino]-4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[(2S,4S)-4-methoxy-1-methylpyrrolidine-2-carbonyl]amino]-4-oxopentanoate?
The IUPAC name of methyl 5-[[(2S,4S)-4-methoxy-1-methylpyrrolidine-2-carbonyl]amino]-4-oxopentanoate (CID 58984947) is methyl 5-[[(2S,4S)-4-methoxy-1-methylpyrrolidine-2-carbonyl]amino]-4-oxopentanoate.
What is the SMILES notation for methyl 5-[[(2S,4S)-4-methoxy-1-methylpyrrolidine-2-carbonyl]amino]-4-oxopentanoate?
The canonical SMILES for methyl 5-[[(2S,4S)-4-methoxy-1-methylpyrrolidine-2-carbonyl]amino]-4-oxopentanoate is COC(=O)CCC(=O)CNC(=O)[C@@H]1C[C@H](OC)CN1C.
What is the InChIKey of methyl 5-[[(2S,4S)-4-methoxy-1-methylpyrrolidine-2-carbonyl]amino]-4-oxopentanoate?
The InChIKey is GTHARAWAGZTILC-QWRGUYRKSA-N. The full InChI is InChI=1S/C13H22N2O5/c1-15-8-10(19-2)6-11(15)13(18)14-7-9(16)4-5-12(17)20-3/h10-11H,4-8H2,1-3H3,(H,14,18)/t10-,11-/m0/s1.
What are the key properties of methyl 5-[[(2S,4S)-4-methoxy-1-methylpyrrolidine-2-carbonyl]amino]-4-oxopentanoate?
methyl 5-[[(2S,4S)-4-methoxy-1-methylpyrrolidine-2-carbonyl]amino]-4-oxopentanoate has a molecular weight of 286.33 g/mol, XLogP of -0.66, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[(2S,4S)-4-methoxy-1-methylpyrrolidine-2-carbonyl]amino]-4-oxopentanoate is sourced from PubChem (CID 58984947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).