About methyl 3-[2-[(2S,3S)-3-ethoxypyrrolidin-2-yl]-1,3-oxazol-5-yl]propanoate
methyl 3-[2-[(2S,3S)-3-ethoxypyrrolidin-2-yl]-1,3-oxazol-5-yl]propanoate (PubChem CID 58985043) has the molecular formula C13H20N2O4
and a molecular weight of 268.31 g/mol. Its IUPAC name is methyl 3-[2-[(2S,3S)-3-ethoxypyrrolidin-2-yl]-1,3-oxazol-5-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[2-[(2S,3S)-3-ethoxypyrrolidin-2-yl]-1,3-oxazol-5-yl]propanoate |
| PubChem CID | 58985043 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | methyl 3-[2-[(2S,3S)-3-ethoxypyrrolidin-2-yl]-1,3-oxazol-5-yl]propanoate |
| SMILES | CCO[C@H]1CCN[C@@H]1c1ncc(CCC(=O)OC)o1 |
| InChI | InChI=1S/C13H20N2O4/c1-3-18-10-6-7-14-12(10)13-15-8-9(19-13)4-5-11(16)17-2/h8,10,12,14H,3-7H2,1-2H3/t10-,12-/m0/s1 |
| InChIKey | RHSODFSQYONYOP-JQWIXIFHSA-N |
| XLogP | 1.22 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[2-[(2S,3S)-3-ethoxypyrrolidin-2-yl]-1,3-oxazol-5-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[2-[(2S,3S)-3-ethoxypyrrolidin-2-yl]-1,3-oxazol-5-yl]propanoate?
The IUPAC name of methyl 3-[2-[(2S,3S)-3-ethoxypyrrolidin-2-yl]-1,3-oxazol-5-yl]propanoate (CID 58985043) is methyl 3-[2-[(2S,3S)-3-ethoxypyrrolidin-2-yl]-1,3-oxazol-5-yl]propanoate.
What is the SMILES notation for methyl 3-[2-[(2S,3S)-3-ethoxypyrrolidin-2-yl]-1,3-oxazol-5-yl]propanoate?
The canonical SMILES for methyl 3-[2-[(2S,3S)-3-ethoxypyrrolidin-2-yl]-1,3-oxazol-5-yl]propanoate is CCO[C@H]1CCN[C@@H]1c1ncc(CCC(=O)OC)o1.
What is the InChIKey of methyl 3-[2-[(2S,3S)-3-ethoxypyrrolidin-2-yl]-1,3-oxazol-5-yl]propanoate?
The InChIKey is RHSODFSQYONYOP-JQWIXIFHSA-N. The full InChI is InChI=1S/C13H20N2O4/c1-3-18-10-6-7-14-12(10)13-15-8-9(19-13)4-5-11(16)17-2/h8,10,12,14H,3-7H2,1-2H3/t10-,12-/m0/s1.
What are the key properties of methyl 3-[2-[(2S,3S)-3-ethoxypyrrolidin-2-yl]-1,3-oxazol-5-yl]propanoate?
methyl 3-[2-[(2S,3S)-3-ethoxypyrrolidin-2-yl]-1,3-oxazol-5-yl]propanoate has a molecular weight of 268.31 g/mol, XLogP of 1.22, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-[(2S,3S)-3-ethoxypyrrolidin-2-yl]-1,3-oxazol-5-yl]propanoate is sourced from PubChem (CID 58985043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).