C22H26N6O4S2 — CID 58985627
ethyl N-[[4-[[4-[[(3E)-3-hydroxyiminobutyl]amino]-5-thiophen-2-ylpyrimidin-2-yl]amino]phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate (PubChem CID 58985627) has the molecular formula C22H26N6O4S2 and a molecular weight of 502.62 g/mol. Its IUPAC name is ethyl N-[[4-[[4-[[(3E)-3-hydroxyiminobutyl]amino]-5-thiophen-2-ylpyrimidin-2-yl]amino]phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate.
| Compound Name | ethyl N-[[4-[[4-[[(3E)-3-hydroxyiminobutyl]amino]-5-thiophen-2-ylpyrimidin-2-yl]amino]phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate |
|---|---|
| PubChem CID | 58985627 |
| Molecular Formula | C22H26N6O4S2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | ethyl N-[[4-[[4-[[(3E)-3-hydroxyiminobutyl]amino]-5-thiophen-2-ylpyrimidin-2-yl]amino]phenyl]-methyl-oxo-λ6-sulfanylidene]carbamate |
| SMILES | CCOC(=O)N=S(C)(=O)c1ccc(Nc2ncc(-c3cccs3)c(NCC/C(C)=N/O)n2)cc1 |
| InChI | InChI=1S/C22H26N6O4S2/c1-4-32-22(29)28-34(3,31)17-9-7-16(8-10-17)25-21-24-14-18(19-6-5-13-33-19)20(26-21)23-12-11-15(2)27-30/h5-10,13-14,30H,4,11-12H2,1-3H3,(H2,23,24,25,26)/b27-15+ |
| InChIKey | RHGLIVNWNONDAR-JFLMPSFJSA-N |
| XLogP | 5.21 |
| TPSA | 138.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|