About 2-tert-butylperoxy-2,5-dimethyl-5-methylperoxyhexane
2-tert-butylperoxy-2,5-dimethyl-5-methylperoxyhexane (PubChem CID 58986388) has the molecular formula C13H28O4
and a molecular weight of 248.36 g/mol. Its IUPAC name is 2-tert-butylperoxy-2,5-dimethyl-5-methylperoxyhexane.
Molecular Properties
| Compound Name | 2-tert-butylperoxy-2,5-dimethyl-5-methylperoxyhexane |
| PubChem CID | 58986388 |
| Molecular Formula | C13H28O4 |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 2-tert-butylperoxy-2,5-dimethyl-5-methylperoxyhexane |
| SMILES | COOC(C)(C)CCC(C)(C)OOC(C)(C)C |
| InChI | InChI=1S/C13H28O4/c1-11(2,3)15-17-13(6,7)10-9-12(4,5)16-14-8/h9-10H2,1-8H3 |
| InChIKey | MDHUGIUZONIYQF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butylperoxy-2,5-dimethyl-5-methylperoxyhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylperoxy-2,5-dimethyl-5-methylperoxyhexane?
The IUPAC name of 2-tert-butylperoxy-2,5-dimethyl-5-methylperoxyhexane (CID 58986388) is 2-tert-butylperoxy-2,5-dimethyl-5-methylperoxyhexane.
What is the SMILES notation for 2-tert-butylperoxy-2,5-dimethyl-5-methylperoxyhexane?
The canonical SMILES for 2-tert-butylperoxy-2,5-dimethyl-5-methylperoxyhexane is COOC(C)(C)CCC(C)(C)OOC(C)(C)C.
What is the InChIKey of 2-tert-butylperoxy-2,5-dimethyl-5-methylperoxyhexane?
The InChIKey is MDHUGIUZONIYQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O4/c1-11(2,3)15-17-13(6,7)10-9-12(4,5)16-14-8/h9-10H2,1-8H3.
What are the key properties of 2-tert-butylperoxy-2,5-dimethyl-5-methylperoxyhexane?
2-tert-butylperoxy-2,5-dimethyl-5-methylperoxyhexane has a molecular weight of 248.36 g/mol, XLogP of 3.65, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylperoxy-2,5-dimethyl-5-methylperoxyhexane is sourced from PubChem (CID 58986388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).