C16H9F3IrN- — CID 58986707
iridium;1-[4-(trifluoromethyl)benzene-6-id-1-yl]isoquinoline (PubChem CID 58986707) has the molecular formula C16H9F3IrN- and a molecular weight of 464.47 g/mol. Its IUPAC name is iridium;1-[4-(trifluoromethyl)benzene-6-id-1-yl]isoquinoline.
| Compound Name | iridium;1-[4-(trifluoromethyl)benzene-6-id-1-yl]isoquinoline |
|---|---|
| PubChem CID | 58986707 |
| Molecular Formula | C16H9F3IrN- |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | iridium;1-[4-(trifluoromethyl)benzene-6-id-1-yl]isoquinoline |
| SMILES | FC(F)(F)c1c[c-]c(-c2nccc3ccccc23)cc1.[Ir] |
| InChI | InChI=1S/C16H9F3N.Ir/c17-16(18,19)13-7-5-12(6-8-13)15-14-4-2-1-3-11(14)9-10-20-15;/h1-5,7-10H;/q-1; |
| InChIKey | YTQYWJULYHMYPR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|