C40H34F4 — CID 58987000
2,7,9,9-tetramethyl-4-[2,3,5,6-tetrafluoro-4-(2,7,9,9-tetramethylfluoren-4-yl)phenyl]fluorene (PubChem CID 58987000) has the molecular formula C40H34F4 and a molecular weight of 590.70 g/mol. Its IUPAC name is 2,7,9,9-tetramethyl-4-[2,3,5,6-tetrafluoro-4-(2,7,9,9-tetramethylfluoren-4-yl)phenyl]fluorene.
| Compound Name | 2,7,9,9-tetramethyl-4-[2,3,5,6-tetrafluoro-4-(2,7,9,9-tetramethylfluoren-4-yl)phenyl]fluorene |
|---|---|
| PubChem CID | 58987000 |
| Molecular Formula | C40H34F4 |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | 2,7,9,9-tetramethyl-4-[2,3,5,6-tetrafluoro-4-(2,7,9,9-tetramethylfluoren-4-yl)phenyl]fluorene |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(C)cc(-c3c(F)c(F)c(-c4cc(C)cc5c4-c4ccc(C)cc4C5(C)C)c(F)c3F)c1-2 |
| InChI | InChI=1S/C40H34F4/c1-19-9-11-23-27(15-19)39(5,6)29-17-21(3)13-25(31(23)29)33-35(41)37(43)34(38(44)36(33)42)26-14-22(4)18-30-32(26)24-12-10-20(2)16-28(24)40(30,7)8/h9-18H,1-8H3 |
| InChIKey | IAHRJNVPRWRWGM-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|