C14H21N3O3 — CID 58987433
(2S)-2-amino-N'-[(3-methoxyphenyl)methyl]-N'-methylpentanediamide (PubChem CID 58987433) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is (2S)-2-amino-N'-[(3-methoxyphenyl)methyl]-N'-methylpentanediamide.
| Compound Name | (2S)-2-amino-N'-[(3-methoxyphenyl)methyl]-N'-methylpentanediamide |
|---|---|
| PubChem CID | 58987433 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (2S)-2-amino-N'-[(3-methoxyphenyl)methyl]-N'-methylpentanediamide |
| SMILES | COc1cccc(CN(C)C(=O)CC[C@H](N)C(N)=O)c1 |
| InChI | InChI=1S/C14H21N3O3/c1-17(13(18)7-6-12(15)14(16)19)9-10-4-3-5-11(8-10)20-2/h3-5,8,12H,6-7,9,15H2,1-2H3,(H2,16,19)/t12-/m0/s1 |
| InChIKey | SFFHVKWTNXNRPX-LBPRGKRZSA-N |
| XLogP | 0.25 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |