About ethyl [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] hydrogen phosphate
ethyl [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] hydrogen phosphate (PubChem CID 58987633) has the molecular formula C20H24N3O8P
and a molecular weight of 465.40 g/mol. Its IUPAC name is ethyl [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] hydrogen phosphate.
Molecular Properties
| Compound Name | ethyl [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] hydrogen phosphate |
| PubChem CID | 58987633 |
| Molecular Formula | C20H24N3O8P |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | ethyl [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] hydrogen phosphate |
| SMILES | CCOP(=O)(O)Oc1cc(-c2cnnn2-c2cc(OC)c(OC)c(OC)c2)ccc1OC |
| InChI | InChI=1S/C20H24N3O8P/c1-6-30-32(24,25)31-17-9-13(7-8-16(17)26-2)15-12-21-22-23(15)14-10-18(27-3)20(29-5)19(11-14)28-4/h7-12H,6H2,1-5H3,(H,24,25) |
| InChIKey | BXHPABUZSKXUFQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 123.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] hydrogen phosphate?
The IUPAC name of ethyl [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] hydrogen phosphate (CID 58987633) is ethyl [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] hydrogen phosphate.
What is the SMILES notation for ethyl [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] hydrogen phosphate?
The canonical SMILES for ethyl [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] hydrogen phosphate is CCOP(=O)(O)Oc1cc(-c2cnnn2-c2cc(OC)c(OC)c(OC)c2)ccc1OC.
What is the InChIKey of ethyl [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] hydrogen phosphate?
The InChIKey is BXHPABUZSKXUFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N3O8P/c1-6-30-32(24,25)31-17-9-13(7-8-16(17)26-2)15-12-21-22-23(15)14-10-18(27-3)20(29-5)19(11-14)28-4/h7-12H,6H2,1-5H3,(H,24,25).
What are the key properties of ethyl [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] hydrogen phosphate?
ethyl [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] hydrogen phosphate has a molecular weight of 465.40 g/mol, XLogP of 3.48, 10 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl [2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl] hydrogen phosphate is sourced from PubChem (CID 58987633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).