C22H42O2Si — CID 58987873
(1R,3aR,7aR)-1-[(2R)-6-[tert-butyl(dimethyl)silyl]oxyhexan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 58987873) has the molecular formula C22H42O2Si and a molecular weight of 366.66 g/mol. Its IUPAC name is (1R,3aR,7aR)-1-[(2R)-6-[tert-butyl(dimethyl)silyl]oxyhexan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-1-[(2R)-6-[tert-butyl(dimethyl)silyl]oxyhexan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 58987873 |
| Molecular Formula | C22H42O2Si |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | (1R,3aR,7aR)-1-[(2R)-6-[tert-butyl(dimethyl)silyl]oxyhexan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | C[C@H](CCCCO[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2C(=O)CCC[C@]12C |
| InChI | InChI=1S/C22H42O2Si/c1-17(11-8-9-16-24-25(6,7)21(2,3)4)18-13-14-19-20(23)12-10-15-22(18,19)5/h17-19H,8-16H2,1-7H3/t17-,18-,19+,22-/m1/s1 |
| InChIKey | HFIXTFGXJPLNRB-NXWNEQKCSA-N |
| XLogP | 6.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|