About [7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-(1H-imidazol-2-yl)methanone
[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-(1H-imidazol-2-yl)methanone (PubChem CID 58988229) has the molecular formula C18H12Cl2N4O
and a molecular weight of 371.23 g/mol. Its IUPAC name is [7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-(1H-imidazol-2-yl)methanone.
Molecular Properties
| Compound Name | [7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-(1H-imidazol-2-yl)methanone |
| PubChem CID | 58988229 |
| Molecular Formula | C18H12Cl2N4O |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | [7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-(1H-imidazol-2-yl)methanone |
| SMILES | Cn1nc2c(-c3ccc(Cl)cc3Cl)cccc2c1C(=O)c1ncc[nH]1 |
| InChI | InChI=1S/C18H12Cl2N4O/c1-24-16(17(25)18-21-7-8-22-18)13-4-2-3-12(15(13)23-24)11-6-5-10(19)9-14(11)20/h2-9H,1H3,(H,21,22) |
| InChIKey | VPHWDMNMDLPBAN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-(1H-imidazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-(1H-imidazol-2-yl)methanone?
The IUPAC name of [7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-(1H-imidazol-2-yl)methanone (CID 58988229) is [7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-(1H-imidazol-2-yl)methanone.
What is the SMILES notation for [7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-(1H-imidazol-2-yl)methanone?
The canonical SMILES for [7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-(1H-imidazol-2-yl)methanone is Cn1nc2c(-c3ccc(Cl)cc3Cl)cccc2c1C(=O)c1ncc[nH]1.
What is the InChIKey of [7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-(1H-imidazol-2-yl)methanone?
The InChIKey is VPHWDMNMDLPBAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12Cl2N4O/c1-24-16(17(25)18-21-7-8-22-18)13-4-2-3-12(15(13)23-24)11-6-5-10(19)9-14(11)20/h2-9H,1H3,(H,21,22).
What are the key properties of [7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-(1H-imidazol-2-yl)methanone?
[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-(1H-imidazol-2-yl)methanone has a molecular weight of 371.23 g/mol, XLogP of 4.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-(1H-imidazol-2-yl)methanone is sourced from PubChem (CID 58988229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).