About 2-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-1,3,4-oxadiazole
2-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-1,3,4-oxadiazole (PubChem CID 58988236) has the molecular formula C16H10Cl2N4O
and a molecular weight of 345.19 g/mol. Its IUPAC name is 2-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-1,3,4-oxadiazole |
| PubChem CID | 58988236 |
| Molecular Formula | C16H10Cl2N4O |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 2-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-1,3,4-oxadiazole |
| SMILES | Cn1nc2c(-c3ccc(Cl)cc3Cl)cccc2c1-c1nnco1 |
| InChI | InChI=1S/C16H10Cl2N4O/c1-22-15(16-20-19-8-23-16)12-4-2-3-11(14(12)21-22)10-6-5-9(17)7-13(10)18/h2-8H,1H3 |
| InChIKey | QLZGGFDHIMEYGL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-1,3,4-oxadiazole?
The IUPAC name of 2-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-1,3,4-oxadiazole (CID 58988236) is 2-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-1,3,4-oxadiazole.
What is the SMILES notation for 2-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-1,3,4-oxadiazole?
The canonical SMILES for 2-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-1,3,4-oxadiazole is Cn1nc2c(-c3ccc(Cl)cc3Cl)cccc2c1-c1nnco1.
What is the InChIKey of 2-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-1,3,4-oxadiazole?
The InChIKey is QLZGGFDHIMEYGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl2N4O/c1-22-15(16-20-19-8-23-16)12-4-2-3-11(14(12)21-22)10-6-5-9(17)7-13(10)18/h2-8H,1H3.
What are the key properties of 2-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-1,3,4-oxadiazole?
2-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-1,3,4-oxadiazole has a molecular weight of 345.19 g/mol, XLogP of 4.60, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-1,3,4-oxadiazole is sourced from PubChem (CID 58988236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).