C20H22Cl2N4O2 — CID 58988252
N-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-N'-(3,3-dimethoxypropyl)methanimidamide (PubChem CID 58988252) has the molecular formula C20H22Cl2N4O2 and a molecular weight of 421.33 g/mol. Its IUPAC name is N-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-N'-(3,3-dimethoxypropyl)methanimidamide.
| Compound Name | N-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-N'-(3,3-dimethoxypropyl)methanimidamide |
|---|---|
| PubChem CID | 58988252 |
| Molecular Formula | C20H22Cl2N4O2 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]-N'-(3,3-dimethoxypropyl)methanimidamide |
| SMILES | COC(CC/N=C/Nc1c2cccc(-c3ccc(Cl)cc3Cl)c2nn1C)OC |
| InChI | InChI=1S/C20H22Cl2N4O2/c1-26-20(24-12-23-10-9-18(27-2)28-3)16-6-4-5-15(19(16)25-26)14-8-7-13(21)11-17(14)22/h4-8,11-12,18H,9-10H2,1-3H3,(H,23,24) |
| InChIKey | XFDOKONGRIUYNB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 60.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|