About [4-[(E)-but-1-enyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate
[4-[(E)-but-1-enyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate (PubChem CID 58988318) has the molecular formula C18H26O4
and a molecular weight of 306.40 g/mol. Its IUPAC name is [4-[(E)-but-1-enyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate.
Molecular Properties
| Compound Name | [4-[(E)-but-1-enyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate |
| PubChem CID | 58988318 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | [4-[(E)-but-1-enyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate |
| SMILES | CC/C=C/C1=C(C)C(=O)C(OC(=O)CCC(C)=O)CC1(C)C |
| InChI | InChI=1S/C18H26O4/c1-6-7-8-14-13(3)17(21)15(11-18(14,4)5)22-16(20)10-9-12(2)19/h7-8,15H,6,9-11H2,1-5H3/b8-7+ |
| InChIKey | NMJIWKICMSZMOT-BQYQJAHWSA-N |
| XLogP | 3.55 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(E)-but-1-enyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E)-but-1-enyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate?
The IUPAC name of [4-[(E)-but-1-enyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate (CID 58988318) is [4-[(E)-but-1-enyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate.
What is the SMILES notation for [4-[(E)-but-1-enyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate?
The canonical SMILES for [4-[(E)-but-1-enyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate is CC/C=C/C1=C(C)C(=O)C(OC(=O)CCC(C)=O)CC1(C)C.
What is the InChIKey of [4-[(E)-but-1-enyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate?
The InChIKey is NMJIWKICMSZMOT-BQYQJAHWSA-N. The full InChI is InChI=1S/C18H26O4/c1-6-7-8-14-13(3)17(21)15(11-18(14,4)5)22-16(20)10-9-12(2)19/h7-8,15H,6,9-11H2,1-5H3/b8-7+.
What are the key properties of [4-[(E)-but-1-enyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate?
[4-[(E)-but-1-enyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate has a molecular weight of 306.40 g/mol, XLogP of 3.55, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E)-but-1-enyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-oxopentanoate is sourced from PubChem (CID 58988318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).