C19H37N3 — CID 58988397
(E,2R,3R)-1-azido-2,3-dimethylheptadec-5-ene (PubChem CID 58988397) has the molecular formula C19H37N3 and a molecular weight of 307.53 g/mol. Its IUPAC name is (E,2R,3R)-1-azido-2,3-dimethylheptadec-5-ene.
| Compound Name | (E,2R,3R)-1-azido-2,3-dimethylheptadec-5-ene |
|---|---|
| PubChem CID | 58988397 |
| Molecular Formula | C19H37N3 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.30 |
| IUPAC Name | (E,2R,3R)-1-azido-2,3-dimethylheptadec-5-ene |
| SMILES | CCCCCCCCCCC/C=C/C[C@@H](C)[C@@H](C)CN=[N+]=[N-] |
| InChI | InChI=1S/C19H37N3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-18(2)19(3)17-21-22-20/h14-15,18-19H,4-13,16-17H2,1-3H3/b15-14+/t18-,19+/m1/s1 |
| InChIKey | VIMOKFALRLEDRG-VPHMPFFRSA-N |
| XLogP | 7.44 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|