About 1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2-methylpropan-1-one
1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2-methylpropan-1-one (PubChem CID 58988641) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is 1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2-methylpropan-1-one.
Molecular Properties
| Compound Name | 1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2-methylpropan-1-one |
| PubChem CID | 58988641 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2-methylpropan-1-one |
| SMILES | C=C[C@@H]1C[C@]1(NC(C)(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C13H23NO/c1-7-10-8-13(10,11(15)9(2)3)14-12(4,5)6/h7,9-10,14H,1,8H2,2-6H3/t10-,13-/m1/s1 |
| InChIKey | BFFBUNFXMDKTIC-ZWNOBZJWSA-N |
| XLogP | 2.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2-methylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2-methylpropan-1-one?
The IUPAC name of 1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2-methylpropan-1-one (CID 58988641) is 1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2-methylpropan-1-one.
What is the SMILES notation for 1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2-methylpropan-1-one?
The canonical SMILES for 1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2-methylpropan-1-one is C=C[C@@H]1C[C@]1(NC(C)(C)C)C(=O)C(C)C.
What is the InChIKey of 1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2-methylpropan-1-one?
The InChIKey is BFFBUNFXMDKTIC-ZWNOBZJWSA-N. The full InChI is InChI=1S/C13H23NO/c1-7-10-8-13(10,11(15)9(2)3)14-12(4,5)6/h7,9-10,14H,1,8H2,2-6H3/t10-,13-/m1/s1.
What are the key properties of 1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2-methylpropan-1-one?
1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2-methylpropan-1-one has a molecular weight of 209.33 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2-methylpropan-1-one is sourced from PubChem (CID 58988641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).