C20H18N3O6- — CID 58989087
3-[(4-methyl-2,5-dioxo-1-phenylpyrrol-3-yl)diazenyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate (PubChem CID 58989087) has the molecular formula C20H18N3O6- and a molecular weight of 396.38 g/mol. Its IUPAC name is 3-[(4-methyl-2,5-dioxo-1-phenylpyrrol-3-yl)diazenyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate.
| Compound Name | 3-[(4-methyl-2,5-dioxo-1-phenylpyrrol-3-yl)diazenyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate |
|---|---|
| PubChem CID | 58989087 |
| Molecular Formula | C20H18N3O6- |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 3-[(4-methyl-2,5-dioxo-1-phenylpyrrol-3-yl)diazenyl]-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-2-olate |
| SMILES | CC1=C(/N=N/C2=C([O-])OC3(CCCCC3)OC2=O)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H19N3O6/c1-12-14(17(25)23(16(12)24)13-8-4-2-5-9-13)21-22-15-18(26)28-20(29-19(15)27)10-6-3-7-11-20/h2,4-5,8-9,26H,3,6-7,10-11H2,1H3/p-1/b22-21+ |
| InChIKey | SEYMYNPCJQPTOP-QURGRASLSA-M |
| XLogP | 2.05 |
| TPSA | 120.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|