C19H24ClNO3 — CID 58989225
3-(4-chloro-2-ethyl-6-methylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one (PubChem CID 58989225) has the molecular formula C19H24ClNO3 and a molecular weight of 349.86 g/mol. Its IUPAC name is 3-(4-chloro-2-ethyl-6-methylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one.
| Compound Name | 3-(4-chloro-2-ethyl-6-methylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 58989225 |
| Molecular Formula | C19H24ClNO3 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 3-(4-chloro-2-ethyl-6-methylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one |
| SMILES | CCc1cc(Cl)cc(C)c1C1=C(O)C2(CCC(OC)CC2)NC1=O |
| InChI | InChI=1S/C19H24ClNO3/c1-4-12-10-13(20)9-11(2)15(12)16-17(22)19(21-18(16)23)7-5-14(24-3)6-8-19/h9-10,14,22H,4-8H2,1-3H3,(H,21,23) |
| InChIKey | WWZLRRMDBPHCHC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |