C14H25NO2 — CID 58990424
5,6-ditert-butyl-2,2-dimethyl-4H-1,4-oxazin-3-one (PubChem CID 58990424) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 5,6-ditert-butyl-2,2-dimethyl-4H-1,4-oxazin-3-one.
| Compound Name | 5,6-ditert-butyl-2,2-dimethyl-4H-1,4-oxazin-3-one |
|---|---|
| PubChem CID | 58990424 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 5,6-ditert-butyl-2,2-dimethyl-4H-1,4-oxazin-3-one |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)OC(C)(C)C(=O)N1 |
| InChI | InChI=1S/C14H25NO2/c1-12(2,3)9-10(13(4,5)6)17-14(7,8)11(16)15-9/h1-8H3,(H,15,16) |
| InChIKey | YFQQDSPFUZVIHI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |