C24H47NO4Si — CID 58991011
(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(5-butyl-3-methylideneoxolan-2-yl)-N-methoxy-N,2-dimethylhexanamide (PubChem CID 58991011) has the molecular formula C24H47NO4Si and a molecular weight of 441.73 g/mol. Its IUPAC name is (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(5-butyl-3-methylideneoxolan-2-yl)-N-methoxy-N,2-dimethylhexanamide.
| Compound Name | (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(5-butyl-3-methylideneoxolan-2-yl)-N-methoxy-N,2-dimethylhexanamide |
|---|---|
| PubChem CID | 58991011 |
| Molecular Formula | C24H47NO4Si |
| Molecular Weight | 441.73 g/mol |
| Exact Mass | 441.33 |
| IUPAC Name | (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(5-butyl-3-methylideneoxolan-2-yl)-N-methoxy-N,2-dimethylhexanamide |
| SMILES | C=C1CC(CCCC)OC1CC[C@H](C[C@@H](C)C(=O)N(C)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H47NO4Si/c1-11-12-13-20-16-18(2)22(28-20)15-14-21(29-30(9,10)24(4,5)6)17-19(3)23(26)25(7)27-8/h19-22H,2,11-17H2,1,3-10H3/t19-,20?,21-,22?/m1/s1 |
| InChIKey | HQWALGVOOFNLBQ-BJTVZRGDSA-N |
| XLogP | 6.11 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.73 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|