C39H63NO5Si2 — CID 58991057
(4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methylideneoxolan-2-yl]-N-methoxy-N,2-dimethylhexanamide (PubChem CID 58991057) has the molecular formula C39H63NO5Si2 and a molecular weight of 682.11 g/mol. Its IUPAC name is (4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methylideneoxolan-2-yl]-N-methoxy-N,2-dimethylhexanamide.
| Compound Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methylideneoxolan-2-yl]-N-methoxy-N,2-dimethylhexanamide |
|---|---|
| PubChem CID | 58991057 |
| Molecular Formula | C39H63NO5Si2 |
| Molecular Weight | 682.11 g/mol |
| Exact Mass | 681.42 |
| IUPAC Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methylideneoxolan-2-yl]-N-methoxy-N,2-dimethylhexanamide |
| SMILES | C=C1C[C@H](CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC1CC[C@H](CC(C)C(=O)N(C)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H63NO5Si2/c1-30-28-32(20-19-27-43-47(39(6,7)8,34-21-15-13-16-22-34)35-23-17-14-18-24-35)44-36(30)26-25-33(45-46(11,12)38(3,4)5)29-31(2)37(41)40(9)42-10/h13-18,21-24,31-33,36H,1,19-20,25-29H2,2-12H3/t31?,32-,33+,36?/m0/s1 |
| InChIKey | XYBADEUNGFWEGT-QNSWFFGHSA-N |
| XLogP | 8.27 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.11 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|