C20H28O6S — CID 58991063
(2R,3R,4R,5S)-4-(benzenesulfonylmethyl)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-5-prop-2-enyloxolan-3-ol (PubChem CID 58991063) has the molecular formula C20H28O6S and a molecular weight of 396.51 g/mol. Its IUPAC name is (2R,3R,4R,5S)-4-(benzenesulfonylmethyl)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-5-prop-2-enyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5S)-4-(benzenesulfonylmethyl)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-5-prop-2-enyloxolan-3-ol |
|---|---|
| PubChem CID | 58991063 |
| Molecular Formula | C20H28O6S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (2R,3R,4R,5S)-4-(benzenesulfonylmethyl)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-5-prop-2-enyloxolan-3-ol |
| SMILES | C=CC[C@@H]1O[C@H](CC2COC(C)(C)O2)[C@H](O)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H28O6S/c1-4-8-17-16(13-27(22,23)15-9-6-5-7-10-15)19(21)18(25-17)11-14-12-24-20(2,3)26-14/h4-7,9-10,14,16-19,21H,1,8,11-13H2,2-3H3/t14?,16-,17-,18+,19+/m0/s1 |
| InChIKey | YZCRLMPQSBFFSS-DNYQBBQESA-N |
| XLogP | 2.32 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|