C12H14O6 — CID 58991068
2-[(1S,3R,6S,8R,12S)-9-oxo-2,7,11-trioxatetracyclo[6.4.1.01,6.010,12]tridecan-3-yl]acetic acid (PubChem CID 58991068) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-[(1S,3R,6S,8R,12S)-9-oxo-2,7,11-trioxatetracyclo[6.4.1.01,6.010,12]tridecan-3-yl]acetic acid.
| Compound Name | 2-[(1S,3R,6S,8R,12S)-9-oxo-2,7,11-trioxatetracyclo[6.4.1.01,6.010,12]tridecan-3-yl]acetic acid |
|---|---|
| PubChem CID | 58991068 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-[(1S,3R,6S,8R,12S)-9-oxo-2,7,11-trioxatetracyclo[6.4.1.01,6.010,12]tridecan-3-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1CC[C@@H]2O[C@@H]3C[C@@]2(O1)[C@H]1OC1C3=O |
| InChI | InChI=1S/C12H14O6/c13-8(14)3-5-1-2-7-12(18-5)4-6(16-7)9(15)10-11(12)17-10/h5-7,10-11H,1-4H2,(H,13,14)/t5-,6-,7+,10?,11+,12+/m1/s1 |
| InChIKey | WAOUXXDOANIKEC-MFCAEAJASA-N |
| XLogP | -0.11 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|