C25H32F4N4O13S — CID 58991284
(2R)-5-oxo-5-(2,3,5,6-tetrafluoro-4-sulfophenoxy)-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid (PubChem CID 58991284) has the molecular formula C25H32F4N4O13S and a molecular weight of 704.60 g/mol. Its IUPAC name is (2R)-5-oxo-5-(2,3,5,6-tetrafluoro-4-sulfophenoxy)-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid.
| Compound Name | (2R)-5-oxo-5-(2,3,5,6-tetrafluoro-4-sulfophenoxy)-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 58991284 |
| Molecular Formula | C25H32F4N4O13S |
| Molecular Weight | 704.60 g/mol |
| Exact Mass | 704.16 |
| IUPAC Name | (2R)-5-oxo-5-(2,3,5,6-tetrafluoro-4-sulfophenoxy)-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN([C@H](CCC(=O)Oc2c(F)c(F)c(S(=O)(=O)O)c(F)c2F)C(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C25H32F4N4O13S/c26-19-21(28)24(47(43,44)45)22(29)20(27)23(19)46-18(40)2-1-14(25(41)42)33-9-7-31(12-16(36)37)5-3-30(11-15(34)35)4-6-32(8-10-33)13-17(38)39/h14H,1-13H2,(H,34,35)(H,36,37)(H,38,39)(H,41,42)(H,43,44,45)/t14-/m1/s1 |
| InChIKey | CFCKDKQFHHVEPP-CQSZACIVSA-N |
| XLogP | -0.90 |
| TPSA | 242.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.60 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|