C26H34F4GdN4O10 — CID 58991295
gadolinium;(2R)-5-oxo-5-(2,3,5,6-tetrafluoro-4-methylphenoxy)-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid (PubChem CID 58991295) has the molecular formula C26H34F4GdN4O10 and a molecular weight of 795.82 g/mol. Its IUPAC name is gadolinium;(2R)-5-oxo-5-(2,3,5,6-tetrafluoro-4-methylphenoxy)-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid.
| Compound Name | gadolinium;(2R)-5-oxo-5-(2,3,5,6-tetrafluoro-4-methylphenoxy)-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 58991295 |
| Molecular Formula | C26H34F4GdN4O10 |
| Molecular Weight | 795.82 g/mol |
| Exact Mass | 796.15 |
| IUPAC Name | gadolinium;(2R)-5-oxo-5-(2,3,5,6-tetrafluoro-4-methylphenoxy)-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid |
| SMILES | Cc1c(F)c(F)c(OC(=O)CC[C@H](C(=O)O)N2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)c(F)c1F.[Gd] |
| InChI | InChI=1S/C26H34F4N4O10.Gd/c1-15-21(27)23(29)25(24(30)22(15)28)44-20(41)3-2-16(26(42)43)34-10-8-32(13-18(37)38)6-4-31(12-17(35)36)5-7-33(9-11-34)14-19(39)40;/h16H,2-14H2,1H3,(H,35,36)(H,37,38)(H,39,40)(H,42,43);/t16-;/m1./s1 |
| InChIKey | NYBFNBLJLRZSOM-PKLMIRHRSA-N |
| XLogP | 0.17 |
| TPSA | 188.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.82 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|