About 5-(4-fluorophenyl)-3-phenyl-2-phenylpyrazine;iridium;pyridine-2-carboxylic acid
5-(4-fluorophenyl)-3-phenyl-2-phenylpyrazine;iridium;pyridine-2-carboxylic acid (PubChem CID 58991337) has the molecular formula C28H19FIrN3O2-
and a molecular weight of 640.69 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3-phenyl-2-phenylpyrazine;iridium;pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-3-phenyl-2-phenylpyrazine;iridium;pyridine-2-carboxylic acid |
| PubChem CID | 58991337 |
| Molecular Formula | C28H19FIrN3O2- |
| Molecular Weight | 640.69 g/mol |
| Exact Mass | 641.11 |
| IUPAC Name | 5-(4-fluorophenyl)-3-phenyl-2-phenylpyrazine;iridium;pyridine-2-carboxylic acid |
| SMILES | Fc1ccc(-c2cnc(-c3[c-]cccc3)c(-c3ccccc3)n2)cc1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C22H14FN2.C6H5NO2.Ir/c23-19-13-11-16(12-14-19)20-15-24-21(17-7-3-1-4-8-17)22(25-20)18-9-5-2-6-10-18;8-6(9)5-3-1-2-4-7-5;/h1-7,9-15H;1-4H,(H,8,9);/q-1;; |
| InChIKey | ZWLSZJDUVIGQOB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 640.69 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-fluorophenyl)-3-phenyl-2-phenylpyrazine;iridium;pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-3-phenyl-2-phenylpyrazine;iridium;pyridine-2-carboxylic acid?
The IUPAC name of 5-(4-fluorophenyl)-3-phenyl-2-phenylpyrazine;iridium;pyridine-2-carboxylic acid (CID 58991337) is 5-(4-fluorophenyl)-3-phenyl-2-phenylpyrazine;iridium;pyridine-2-carboxylic acid.
What is the SMILES notation for 5-(4-fluorophenyl)-3-phenyl-2-phenylpyrazine;iridium;pyridine-2-carboxylic acid?
The canonical SMILES for 5-(4-fluorophenyl)-3-phenyl-2-phenylpyrazine;iridium;pyridine-2-carboxylic acid is Fc1ccc(-c2cnc(-c3[c-]cccc3)c(-c3ccccc3)n2)cc1.O=C(O)c1ccccn1.[Ir].
What is the InChIKey of 5-(4-fluorophenyl)-3-phenyl-2-phenylpyrazine;iridium;pyridine-2-carboxylic acid?
The InChIKey is ZWLSZJDUVIGQOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14FN2.C6H5NO2.Ir/c23-19-13-11-16(12-14-19)20-15-24-21(17-7-3-1-4-8-17)22(25-20)18-9-5-2-6-10-18;8-6(9)5-3-1-2-4-7-5;/h1-7,9-15H;1-4H,(H,8,9);/q-1;;.
What are the key properties of 5-(4-fluorophenyl)-3-phenyl-2-phenylpyrazine;iridium;pyridine-2-carboxylic acid?
5-(4-fluorophenyl)-3-phenyl-2-phenylpyrazine;iridium;pyridine-2-carboxylic acid has a molecular weight of 640.69 g/mol, XLogP of 6.19, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-3-phenyl-2-phenylpyrazine;iridium;pyridine-2-carboxylic acid is sourced from PubChem (CID 58991337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).