C16H24O5 — CID 58991576
[(1S,2R,3R,4R)-3-formyl-4-(oxan-2-yloxy)-2-prop-2-enylcyclopentyl] acetate (PubChem CID 58991576) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is [(1S,2R,3R,4R)-3-formyl-4-(oxan-2-yloxy)-2-prop-2-enylcyclopentyl] acetate.
| Compound Name | [(1S,2R,3R,4R)-3-formyl-4-(oxan-2-yloxy)-2-prop-2-enylcyclopentyl] acetate |
|---|---|
| PubChem CID | 58991576 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | [(1S,2R,3R,4R)-3-formyl-4-(oxan-2-yloxy)-2-prop-2-enylcyclopentyl] acetate |
| SMILES | C=CC[C@@H]1[C@@H](C=O)[C@H](OC2CCCCO2)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H24O5/c1-3-6-12-13(10-17)15(9-14(12)20-11(2)18)21-16-7-4-5-8-19-16/h3,10,12-16H,1,4-9H2,2H3/t12-,13-,14+,15-,16?/m1/s1 |
| InChIKey | FHLMIOUHNHYZIJ-IWQYDBTJSA-N |
| XLogP | 2.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|