C23H40N2O2 — CID 58991582
(2S)-N-[1-[(3R,3aS,6aR)-3-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-cyclohexylpropanamide (PubChem CID 58991582) has the molecular formula C23H40N2O2 and a molecular weight of 376.59 g/mol. Its IUPAC name is (2S)-N-[1-[(3R,3aS,6aR)-3-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-cyclohexylpropanamide.
| Compound Name | (2S)-N-[1-[(3R,3aS,6aR)-3-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-cyclohexylpropanamide |
|---|---|
| PubChem CID | 58991582 |
| Molecular Formula | C23H40N2O2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.31 |
| IUPAC Name | (2S)-N-[1-[(3R,3aS,6aR)-3-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-cyclohexylpropanamide |
| SMILES | C[C@H](C(=O)NC(C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C23H40N2O2/c1-15(17-10-7-6-8-11-17)21(26)24-20(23(3,4)5)22(27)25-14-18-12-9-13-19(18)16(25)2/h15-20H,6-14H2,1-5H3,(H,24,26)/t15-,16+,18-,19+,20?/m0/s1 |
| InChIKey | MSCMEQICFFRWGN-QVFIUTARSA-N |
| XLogP | 4.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |