About 1-ethoxyhexadecan-2-one
1-ethoxyhexadecan-2-one (PubChem CID 58991968) has the molecular formula C18H36O2
and a molecular weight of 284.48 g/mol. Its IUPAC name is 1-ethoxyhexadecan-2-one.
Molecular Properties
| Compound Name | 1-ethoxyhexadecan-2-one |
| PubChem CID | 58991968 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | 1-ethoxyhexadecan-2-one |
| SMILES | CCCCCCCCCCCCCCC(=O)COCC |
| InChI | InChI=1S/C18H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-18(19)17-20-4-2/h3-17H2,1-2H3 |
| InChIKey | CTPYPEFWTMKAKO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxyhexadecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyhexadecan-2-one?
The IUPAC name of 1-ethoxyhexadecan-2-one (CID 58991968) is 1-ethoxyhexadecan-2-one.
What is the SMILES notation for 1-ethoxyhexadecan-2-one?
The canonical SMILES for 1-ethoxyhexadecan-2-one is CCCCCCCCCCCCCCC(=O)COCC.
What is the InChIKey of 1-ethoxyhexadecan-2-one?
The InChIKey is CTPYPEFWTMKAKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-18(19)17-20-4-2/h3-17H2,1-2H3.
What are the key properties of 1-ethoxyhexadecan-2-one?
1-ethoxyhexadecan-2-one has a molecular weight of 284.48 g/mol, XLogP of 5.68, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyhexadecan-2-one is sourced from PubChem (CID 58991968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).