C24H30ClN2O+ — CID 58992119
4-[(E)-2-(5-chloro-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-N,N-diethyl-3-methoxyaniline (PubChem CID 58992119) has the molecular formula C24H30ClN2O+ and a molecular weight of 397.97 g/mol. Its IUPAC name is 4-[(E)-2-(5-chloro-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-N,N-diethyl-3-methoxyaniline.
| Compound Name | 4-[(E)-2-(5-chloro-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-N,N-diethyl-3-methoxyaniline |
|---|---|
| PubChem CID | 58992119 |
| Molecular Formula | C24H30ClN2O+ |
| Molecular Weight | 397.97 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 4-[(E)-2-(5-chloro-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-N,N-diethyl-3-methoxyaniline |
| SMILES | CCN(CC)c1ccc(/C=C/C2=[N+](C)c3ccc(Cl)cc3C2(C)C)c(OC)c1 |
| InChI | InChI=1S/C24H30ClN2O/c1-7-27(8-2)19-12-9-17(22(16-19)28-6)10-14-23-24(3,4)20-15-18(25)11-13-21(20)26(23)5/h9-16H,7-8H2,1-6H3/q+1 |
| InChIKey | GRKMACJWRMQLRA-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.97 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|