About N-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]-4-propan-2-ylaniline
N-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]-4-propan-2-ylaniline (PubChem CID 58992134) has the molecular formula C20H24N5+
and a molecular weight of 334.45 g/mol. Its IUPAC name is N-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]-4-propan-2-ylaniline.
Molecular Properties
| Compound Name | N-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]-4-propan-2-ylaniline |
| PubChem CID | 58992134 |
| Molecular Formula | C20H24N5+ |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]-4-propan-2-ylaniline |
| SMILES | CC(C)c1ccc(Nc2ccc(/N=N/c3n(C)cc[n+]3C)cc2)cc1 |
| InChI | InChI=1S/C20H23N5/c1-15(2)16-5-7-17(8-6-16)21-18-9-11-19(12-10-18)22-23-20-24(3)13-14-25(20)4/h5-15H,1-4H3/p+1 |
| InChIKey | GZCPIERRGXKEJD-UHFFFAOYSA-O |
| XLogP | 5.13 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]-4-propan-2-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]-4-propan-2-ylaniline?
The IUPAC name of N-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]-4-propan-2-ylaniline (CID 58992134) is N-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]-4-propan-2-ylaniline.
What is the SMILES notation for N-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]-4-propan-2-ylaniline?
The canonical SMILES for N-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]-4-propan-2-ylaniline is CC(C)c1ccc(Nc2ccc(/N=N/c3n(C)cc[n+]3C)cc2)cc1.
What is the InChIKey of N-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]-4-propan-2-ylaniline?
The InChIKey is GZCPIERRGXKEJD-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H23N5/c1-15(2)16-5-7-17(8-6-16)21-18-9-11-19(12-10-18)22-23-20-24(3)13-14-25(20)4/h5-15H,1-4H3/p+1.
What are the key properties of N-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]-4-propan-2-ylaniline?
N-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]-4-propan-2-ylaniline has a molecular weight of 334.45 g/mol, XLogP of 5.13, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]-4-propan-2-ylaniline is sourced from PubChem (CID 58992134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).