C16H16FN6+ — CID 58992145
4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N-(4-fluorophenyl)aniline (PubChem CID 58992145) has the molecular formula C16H16FN6+ and a molecular weight of 311.34 g/mol. Its IUPAC name is 4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N-(4-fluorophenyl)aniline.
| Compound Name | 4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N-(4-fluorophenyl)aniline |
|---|---|
| PubChem CID | 58992145 |
| Molecular Formula | C16H16FN6+ |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N-(4-fluorophenyl)aniline |
| SMILES | Cn1nc[n+](C)c1/N=N/c1ccc(Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H15FN6/c1-22-11-18-23(2)16(22)21-20-15-9-7-14(8-10-15)19-13-5-3-12(17)4-6-13/h3-11H,1-2H3/p+1 |
| InChIKey | NNPRCTUGSSBFBQ-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 58.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|