C21H23NO4 — CID 58992661
benzyl 1-(2-methoxycarbonylphenyl)piperidine-3-carboxylate (PubChem CID 58992661) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is benzyl 1-(2-methoxycarbonylphenyl)piperidine-3-carboxylate.
| Compound Name | benzyl 1-(2-methoxycarbonylphenyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 58992661 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | benzyl 1-(2-methoxycarbonylphenyl)piperidine-3-carboxylate |
| SMILES | COC(=O)c1ccccc1N1CCCC(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H23NO4/c1-25-21(24)18-11-5-6-12-19(18)22-13-7-10-17(14-22)20(23)26-15-16-8-3-2-4-9-16/h2-6,8-9,11-12,17H,7,10,13-15H2,1H3 |
| InChIKey | HMFAOQZBIJVZMH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |