C37H45FN2O4 — CID 58992875
tert-butyl 2-[(4R,6S)-6-[(E)-2-[14-amino-4-(4-fluorophenyl)-6-propan-2-yl-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-5-yl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 58992875) has the molecular formula C37H45FN2O4 and a molecular weight of 600.78 g/mol. Its IUPAC name is tert-butyl 2-[(4R,6S)-6-[(E)-2-[14-amino-4-(4-fluorophenyl)-6-propan-2-yl-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-5-yl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4R,6S)-6-[(E)-2-[14-amino-4-(4-fluorophenyl)-6-propan-2-yl-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-5-yl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 58992875 |
| Molecular Formula | C37H45FN2O4 |
| Molecular Weight | 600.78 g/mol |
| Exact Mass | 600.34 |
| IUPAC Name | tert-butyl 2-[(4R,6S)-6-[(E)-2-[14-amino-4-(4-fluorophenyl)-6-propan-2-yl-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-5-yl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | CC(C)c1nc2c(c(-c3ccc(F)cc3)c1/C=C/[C@@H]1C[C@H](CC(=O)OC(C)(C)C)OC(C)(C)O1)Cc1cc(N)ccc1CC2 |
| InChI | InChI=1S/C37H45FN2O4/c1-22(2)35-30(16-15-28-20-29(43-37(6,7)42-28)21-33(41)44-36(3,4)5)34(24-8-12-26(38)13-9-24)31-19-25-18-27(39)14-10-23(25)11-17-32(31)40-35/h8-10,12-16,18,22,28-29H,11,17,19-21,39H2,1-7H3/b16-15+/t28-,29-/m1/s1 |
| InChIKey | CDBDGUJLBPMFOV-IEEGESTASA-N |
| XLogP | 7.94 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.78 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|