C32H27FN2O3 — CID 58992922
2-[6-(4-fluorophenyl)-5-(hydroxymethyl)-4-propan-2-yl-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-13-yl]isoindole-1,3-dione (PubChem CID 58992922) has the molecular formula C32H27FN2O3 and a molecular weight of 506.58 g/mol. Its IUPAC name is 2-[6-(4-fluorophenyl)-5-(hydroxymethyl)-4-propan-2-yl-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-13-yl]isoindole-1,3-dione.
| Compound Name | 2-[6-(4-fluorophenyl)-5-(hydroxymethyl)-4-propan-2-yl-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-13-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58992922 |
| Molecular Formula | C32H27FN2O3 |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 2-[6-(4-fluorophenyl)-5-(hydroxymethyl)-4-propan-2-yl-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-13-yl]isoindole-1,3-dione |
| SMILES | CC(C)c1nc2c(c(-c3ccc(F)cc3)c1CO)CCCc1cc(N3C(=O)c4ccccc4C3=O)ccc1-2 |
| InChI | InChI=1S/C32H27FN2O3/c1-18(2)29-27(17-36)28(19-10-12-21(33)13-11-19)26-9-5-6-20-16-22(14-15-23(20)30(26)34-29)35-31(37)24-7-3-4-8-25(24)32(35)38/h3-4,7-8,10-16,18,36H,5-6,9,17H2,1-2H3 |
| InChIKey | CIEOFKVUDOYUFH-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|