About propanimidoyl 4-methylpiperidine-1-carboximidate
propanimidoyl 4-methylpiperidine-1-carboximidate (PubChem CID 58993170) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is propanimidoyl 4-methylpiperidine-1-carboximidate.
Molecular Properties
| Compound Name | propanimidoyl 4-methylpiperidine-1-carboximidate |
| PubChem CID | 58993170 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | propanimidoyl 4-methylpiperidine-1-carboximidate |
| SMILES | [H]/N=C(\O/C(CC)=N/[H])N1CCC(C)CC1 |
| InChI | InChI=1S/C10H19N3O/c1-3-9(11)14-10(12)13-6-4-8(2)5-7-13/h8,11-12H,3-7H2,1-2H3/b11-9+,12-10- |
| InChIKey | RCSXLXZUCJLNNY-IXIPZQGVSA-N |
| XLogP | 2.06 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze propanimidoyl 4-methylpiperidine-1-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanimidoyl 4-methylpiperidine-1-carboximidate?
The IUPAC name of propanimidoyl 4-methylpiperidine-1-carboximidate (CID 58993170) is propanimidoyl 4-methylpiperidine-1-carboximidate.
What is the SMILES notation for propanimidoyl 4-methylpiperidine-1-carboximidate?
The canonical SMILES for propanimidoyl 4-methylpiperidine-1-carboximidate is [H]/N=C(\O/C(CC)=N/[H])N1CCC(C)CC1.
What is the InChIKey of propanimidoyl 4-methylpiperidine-1-carboximidate?
The InChIKey is RCSXLXZUCJLNNY-IXIPZQGVSA-N. The full InChI is InChI=1S/C10H19N3O/c1-3-9(11)14-10(12)13-6-4-8(2)5-7-13/h8,11-12H,3-7H2,1-2H3/b11-9+,12-10-.
What are the key properties of propanimidoyl 4-methylpiperidine-1-carboximidate?
propanimidoyl 4-methylpiperidine-1-carboximidate has a molecular weight of 197.28 g/mol, XLogP of 2.06, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propanimidoyl 4-methylpiperidine-1-carboximidate is sourced from PubChem (CID 58993170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).