C35H34N6O6 — CID 58993385
(17-hydroxy-3,5-dioxo-4,14,19-triazaheptacyclo[12.11.2.02,6.07,27.08,13.019,26.020,25]heptacosa-1,6,8,10,12,20,22,24,26-nonaen-16-yl) 4-(2-pyrrolidin-1-ylacetyl)piperazine-1-carboxylate (PubChem CID 58993385) has the molecular formula C35H34N6O6 and a molecular weight of 634.69 g/mol. Its IUPAC name is (17-hydroxy-3,5-dioxo-4,14,19-triazaheptacyclo[12.11.2.02,6.07,27.08,13.019,26.020,25]heptacosa-1,6,8,10,12,20,22,24,26-nonaen-16-yl) 4-(2-pyrrolidin-1-ylacetyl)piperazine-1-carboxylate.
| Compound Name | (17-hydroxy-3,5-dioxo-4,14,19-triazaheptacyclo[12.11.2.02,6.07,27.08,13.019,26.020,25]heptacosa-1,6,8,10,12,20,22,24,26-nonaen-16-yl) 4-(2-pyrrolidin-1-ylacetyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58993385 |
| Molecular Formula | C35H34N6O6 |
| Molecular Weight | 634.69 g/mol |
| Exact Mass | 634.25 |
| IUPAC Name | (17-hydroxy-3,5-dioxo-4,14,19-triazaheptacyclo[12.11.2.02,6.07,27.08,13.019,26.020,25]heptacosa-1,6,8,10,12,20,22,24,26-nonaen-16-yl) 4-(2-pyrrolidin-1-ylacetyl)piperazine-1-carboxylate |
| SMILES | O=C1NC(=O)c2c1c1c3ccccc3n3c1c1c2c2ccccc2n1CC(OC(=O)N1CCN(C(=O)CN2CCCC2)CC1)C(O)C3 |
| InChI | InChI=1S/C35H34N6O6/c42-24-17-40-22-9-3-1-7-20(22)27-29-30(34(45)36-33(29)44)28-21-8-2-4-10-23(21)41(32(28)31(27)40)18-25(24)47-35(46)39-15-13-38(14-16-39)26(43)19-37-11-5-6-12-37/h1-4,7-10,24-25,42H,5-6,11-19H2,(H,36,44,45) |
| InChIKey | NXCUDNSHMCOVGB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 129.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.69 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|