C31H29N5O6 — CID 58993401
16,17-dihydroxy-16-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-4,14,19-triazaheptacyclo[12.11.2.02,6.07,27.08,13.019,26.020,25]heptacosa-1,6,8,10,12,20,22,24,26-nonaene-3,5-dione (PubChem CID 58993401) has the molecular formula C31H29N5O6 and a molecular weight of 567.60 g/mol. Its IUPAC name is 16,17-dihydroxy-16-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-4,14,19-triazaheptacyclo[12.11.2.02,6.07,27.08,13.019,26.020,25]heptacosa-1,6,8,10,12,20,22,24,26-nonaene-3,5-dione.
| Compound Name | 16,17-dihydroxy-16-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-4,14,19-triazaheptacyclo[12.11.2.02,6.07,27.08,13.019,26.020,25]heptacosa-1,6,8,10,12,20,22,24,26-nonaene-3,5-dione |
|---|---|
| PubChem CID | 58993401 |
| Molecular Formula | C31H29N5O6 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | 16,17-dihydroxy-16-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-4,14,19-triazaheptacyclo[12.11.2.02,6.07,27.08,13.019,26.020,25]heptacosa-1,6,8,10,12,20,22,24,26-nonaene-3,5-dione |
| SMILES | O=C1NC(=O)c2c1c1c3ccccc3n3c1c1c2c2ccccc2n1CC(O)(C(=O)N1CCN(CCO)CC1)C(O)C3 |
| InChI | InChI=1S/C31H29N5O6/c37-14-13-33-9-11-34(12-10-33)30(41)31(42)16-36-20-8-4-2-6-18(20)23-25-24(28(39)32-29(25)40)22-17-5-1-3-7-19(17)35(15-21(31)38)26(22)27(23)36/h1-8,21,37-38,42H,9-16H2,(H,32,39,40) |
| InChIKey | LQUCSFHQIHKMFZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|