C30H40N4O — CID 58993727
N-[4-[4-(diethylamino)cyclohexyl]-2-(4,4-dimethylcyclohexen-1-yl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide (PubChem CID 58993727) has the molecular formula C30H40N4O and a molecular weight of 472.68 g/mol. Its IUPAC name is N-[4-[4-(diethylamino)cyclohexyl]-2-(4,4-dimethylcyclohexen-1-yl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide.
| Compound Name | N-[4-[4-(diethylamino)cyclohexyl]-2-(4,4-dimethylcyclohexen-1-yl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 58993727 |
| Molecular Formula | C30H40N4O |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | N-[4-[4-(diethylamino)cyclohexyl]-2-(4,4-dimethylcyclohexen-1-yl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide |
| SMILES | C#Cc1cnc(C(=O)Nc2ccc(C3CCC(N(CC)CC)CC3)cc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C30H40N4O/c1-6-24-20-31-28(32-24)29(35)33-27-14-11-23(19-26(27)22-15-17-30(4,5)18-16-22)21-9-12-25(13-10-21)34(7-2)8-3/h1,11,14-15,19-21,25H,7-10,12-13,16-18H2,2-5H3,(H,31,32)(H,33,35) |
| InChIKey | JOXKAOPNCMQJQG-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|