C26H32N4O4S — CID 58994400
N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2-morpholin-4-ylsulfonylethyl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide (PubChem CID 58994400) has the molecular formula C26H32N4O4S and a molecular weight of 496.63 g/mol. Its IUPAC name is N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2-morpholin-4-ylsulfonylethyl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide.
| Compound Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2-morpholin-4-ylsulfonylethyl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 58994400 |
| Molecular Formula | C26H32N4O4S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2-morpholin-4-ylsulfonylethyl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide |
| SMILES | C#Cc1cnc(C(=O)Nc2ccc(CCS(=O)(=O)N3CCOCC3)cc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C26H32N4O4S/c1-4-21-18-27-24(28-21)25(31)29-23-6-5-19(9-16-35(32,33)30-12-14-34-15-13-30)17-22(23)20-7-10-26(2,3)11-8-20/h1,5-7,17-18H,8-16H2,2-3H3,(H,27,28)(H,29,31) |
| InChIKey | YEIDSRGSZOVQRZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|