C26H34N2 — CID 58994667
1-(2,6-diethylphenyl)-3-methyl-N,N-dipropylisoquinolin-4-amine (PubChem CID 58994667) has the molecular formula C26H34N2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-methyl-N,N-dipropylisoquinolin-4-amine.
| Compound Name | 1-(2,6-diethylphenyl)-3-methyl-N,N-dipropylisoquinolin-4-amine |
|---|---|
| PubChem CID | 58994667 |
| Molecular Formula | C26H34N2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-methyl-N,N-dipropylisoquinolin-4-amine |
| SMILES | CCCN(CCC)c1c(C)nc(-c2c(CC)cccc2CC)c2ccccc12 |
| InChI | InChI=1S/C26H34N2/c1-6-17-28(18-7-2)26-19(5)27-25(22-15-10-11-16-23(22)26)24-20(8-3)13-12-14-21(24)9-4/h10-16H,6-9,17-18H2,1-5H3 |
| InChIKey | CPJIZBYZEANQGF-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |