C30H41F3N4O2 — CID 58994954
N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[4-hydroxy-2,2,6,6-tetramethyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]-5-methyl-1H-imidazole-2-carboxamide (PubChem CID 58994954) has the molecular formula C30H41F3N4O2 and a molecular weight of 546.68 g/mol. Its IUPAC name is N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[4-hydroxy-2,2,6,6-tetramethyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]-5-methyl-1H-imidazole-2-carboxamide.
| Compound Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[4-hydroxy-2,2,6,6-tetramethyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]-5-methyl-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 58994954 |
| Molecular Formula | C30H41F3N4O2 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[4-hydroxy-2,2,6,6-tetramethyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]-5-methyl-1H-imidazole-2-carboxamide |
| SMILES | Cc1cnc(C(=O)Nc2ccc(C3(O)CC(C)(C)N(CC(F)(F)F)C(C)(C)C3)cc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C30H41F3N4O2/c1-19-15-34-24(35-19)25(38)36-23-9-8-21(14-22(23)20-10-12-26(2,3)13-11-20)29(39)16-27(4,5)37(18-30(31,32)33)28(6,7)17-29/h8-10,14-15,39H,11-13,16-18H2,1-7H3,(H,34,35)(H,36,38) |
| InChIKey | ITZWCHPBBVOEQE-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |