C29H37N5O2 — CID 58994981
N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(4-piperazin-1-yloxan-4-yl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide (PubChem CID 58994981) has the molecular formula C29H37N5O2 and a molecular weight of 487.65 g/mol. Its IUPAC name is N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(4-piperazin-1-yloxan-4-yl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide.
| Compound Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(4-piperazin-1-yloxan-4-yl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 58994981 |
| Molecular Formula | C29H37N5O2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(4-piperazin-1-yloxan-4-yl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide |
| SMILES | C#Cc1cnc(C(=O)Nc2ccc(C3(N4CCNCC4)CCOCC3)cc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C29H37N5O2/c1-4-23-20-31-26(32-23)27(35)33-25-6-5-22(19-24(25)21-7-9-28(2,3)10-8-21)29(11-17-36-18-12-29)34-15-13-30-14-16-34/h1,5-7,19-20,30H,8-18H2,2-3H3,(H,31,32)(H,33,35) |
| InChIKey | YHSXWRIWXJKDRG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|