C32H44N4O5Si — CID 58994985
methyl 4-[4-[[4-cyano-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]-3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxane-4-carboxylate (PubChem CID 58994985) has the molecular formula C32H44N4O5Si and a molecular weight of 592.81 g/mol. Its IUPAC name is methyl 4-[4-[[4-cyano-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]-3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxane-4-carboxylate.
| Compound Name | methyl 4-[4-[[4-cyano-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]-3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxane-4-carboxylate |
|---|---|
| PubChem CID | 58994985 |
| Molecular Formula | C32H44N4O5Si |
| Molecular Weight | 592.81 g/mol |
| Exact Mass | 592.31 |
| IUPAC Name | methyl 4-[4-[[4-cyano-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]-3-(4,4-dimethylcyclohexen-1-yl)phenyl]oxane-4-carboxylate |
| SMILES | COC(=O)C1(c2ccc(NC(=O)c3nc(C#N)cn3COCC[Si](C)(C)C)c(C3=CCC(C)(C)CC3)c2)CCOCC1 |
| InChI | InChI=1S/C32H44N4O5Si/c1-31(2)11-9-23(10-12-31)26-19-24(32(30(38)39-3)13-15-40-16-14-32)7-8-27(26)35-29(37)28-34-25(20-33)21-36(28)22-41-17-18-42(4,5)6/h7-9,19,21H,10-18,22H2,1-6H3,(H,35,37) |
| InChIKey | CODILCQCHLVDLG-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.81 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|