C28H36N4O3 — CID 58994996
N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[4-(2-methoxyethylamino)oxan-4-yl]phenyl]-5-ethynyl-1H-imidazole-2-carboxamide (PubChem CID 58994996) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[4-(2-methoxyethylamino)oxan-4-yl]phenyl]-5-ethynyl-1H-imidazole-2-carboxamide.
| Compound Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[4-(2-methoxyethylamino)oxan-4-yl]phenyl]-5-ethynyl-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 58994996 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[4-(2-methoxyethylamino)oxan-4-yl]phenyl]-5-ethynyl-1H-imidazole-2-carboxamide |
| SMILES | C#Cc1cnc(C(=O)Nc2ccc(C3(NCCOC)CCOCC3)cc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C28H36N4O3/c1-5-22-19-29-25(31-22)26(33)32-24-7-6-21(18-23(24)20-8-10-27(2,3)11-9-20)28(30-14-17-34-4)12-15-35-16-13-28/h1,6-8,18-19,30H,9-17H2,2-4H3,(H,29,31)(H,32,33) |
| InChIKey | SCIQMYXPIFDMCP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|