C29H39N5O4S — CID 58995006
N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[4-(2-methoxyethylamino)-2,6-dimethyl-1,1-dioxothian-4-yl]phenyl]-5-isocyano-1H-imidazole-2-carboxamide (PubChem CID 58995006) has the molecular formula C29H39N5O4S and a molecular weight of 553.73 g/mol. Its IUPAC name is N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[4-(2-methoxyethylamino)-2,6-dimethyl-1,1-dioxothian-4-yl]phenyl]-5-isocyano-1H-imidazole-2-carboxamide.
| Compound Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[4-(2-methoxyethylamino)-2,6-dimethyl-1,1-dioxothian-4-yl]phenyl]-5-isocyano-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 58995006 |
| Molecular Formula | C29H39N5O4S |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[4-(2-methoxyethylamino)-2,6-dimethyl-1,1-dioxothian-4-yl]phenyl]-5-isocyano-1H-imidazole-2-carboxamide |
| SMILES | [C-]#[N+]c1cnc(C(=O)Nc2ccc(C3(NCCOC)CC(C)S(=O)(=O)C(C)C3)cc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C29H39N5O4S/c1-19-16-29(32-13-14-38-6,17-20(2)39(19,36)37)22-7-8-24(33-27(35)26-31-18-25(30-5)34-26)23(15-22)21-9-11-28(3,4)12-10-21/h7-9,15,18-20,32H,10-14,16-17H2,1-4,6H3,(H,31,34)(H,33,35) |
| InChIKey | IQUMYCCYLZXKLZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|