C25H29N3O4S — CID 58995030
N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(4-hydroxy-1,1-dioxothian-4-yl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide (PubChem CID 58995030) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(4-hydroxy-1,1-dioxothian-4-yl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide.
| Compound Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(4-hydroxy-1,1-dioxothian-4-yl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 58995030 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(4-hydroxy-1,1-dioxothian-4-yl)phenyl]-5-ethynyl-1H-imidazole-2-carboxamide |
| SMILES | C#Cc1cnc(C(=O)Nc2ccc(C3(O)CCS(=O)(=O)CC3)cc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C25H29N3O4S/c1-4-19-16-26-22(27-19)23(29)28-21-6-5-18(25(30)11-13-33(31,32)14-12-25)15-20(21)17-7-9-24(2,3)10-8-17/h1,5-7,15-16,30H,8-14H2,2-3H3,(H,26,27)(H,28,29) |
| InChIKey | XHIXBSMZBYBUKW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|