About cis-(1R,2S)-2-[[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]cyclopropane-1-carboxylic acid
cis-(1R,2S)-2-[[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 58995073) has the molecular formula C16H13FN2O4
and a molecular weight of 316.29 g/mol. Its IUPAC name is cis-(1R,2S)-2-[[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | cis-(1R,2S)-2-[[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]cyclopropane-1-carboxylic acid |
| PubChem CID | 58995073 |
| Molecular Formula | C16H13FN2O4 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | cis-(1R,2S)-2-[[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(Nc1ccc(-n2ccccc2=O)cc1F)[C@H]1C[C@H]1C(=O)O |
| InChI | InChI=1S/C16H13FN2O4/c17-12-7-9(19-6-2-1-3-14(19)20)4-5-13(12)18-15(21)10-8-11(10)16(22)23/h1-7,10-11H,8H2,(H,18,21)(H,22,23)/t10-,11+/m0/s1 |
| InChIKey | WCNZWVSKOGNZLV-WDEREUQCSA-N |
| XLogP | 1.64 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cis-(1R,2S)-2-[[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-2-[[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]cyclopropane-1-carboxylic acid?
The IUPAC name of cis-(1R,2S)-2-[[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]cyclopropane-1-carboxylic acid (CID 58995073) is cis-(1R,2S)-2-[[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]cyclopropane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,2S)-2-[[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]cyclopropane-1-carboxylic acid?
The canonical SMILES for cis-(1R,2S)-2-[[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]cyclopropane-1-carboxylic acid is O=C(Nc1ccc(-n2ccccc2=O)cc1F)[C@H]1C[C@H]1C(=O)O.
What is the InChIKey of cis-(1R,2S)-2-[[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]cyclopropane-1-carboxylic acid?
The InChIKey is WCNZWVSKOGNZLV-WDEREUQCSA-N. The full InChI is InChI=1S/C16H13FN2O4/c17-12-7-9(19-6-2-1-3-14(19)20)4-5-13(12)18-15(21)10-8-11(10)16(22)23/h1-7,10-11H,8H2,(H,18,21)(H,22,23)/t10-,11+/m0/s1.
What are the key properties of cis-(1R,2S)-2-[[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]cyclopropane-1-carboxylic acid?
cis-(1R,2S)-2-[[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]cyclopropane-1-carboxylic acid has a molecular weight of 316.29 g/mol, XLogP of 1.64, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-[[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]cyclopropane-1-carboxylic acid is sourced from PubChem (CID 58995073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).