C15H23NO4 — CID 58995119
(1S,2S,6R,9S)-9-tert-butyl-2,4-dimethyl-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carbaldehyde (PubChem CID 58995119) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is (1S,2S,6R,9S)-9-tert-butyl-2,4-dimethyl-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carbaldehyde.
| Compound Name | (1S,2S,6R,9S)-9-tert-butyl-2,4-dimethyl-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carbaldehyde |
|---|---|
| PubChem CID | 58995119 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (1S,2S,6R,9S)-9-tert-butyl-2,4-dimethyl-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carbaldehyde |
| SMILES | CC1C[C@H]2C(=O)N3[C@H](C(C)(C)C)OC[C@@]3(C=O)[C@@]2(C)O1 |
| InChI | InChI=1S/C15H23NO4/c1-9-6-10-11(18)16-12(13(2,3)4)19-8-15(16,7-17)14(10,5)20-9/h7,9-10,12H,6,8H2,1-5H3/t9?,10-,12-,14-,15-/m0/s1 |
| InChIKey | JWALIMDJGLSHCN-SDJSPTQGSA-N |
| XLogP | 1.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|