C9H17N3O4S — CID 58995146
3-(3,5,5-trimethyl-2,4-dioxoimidazolidin-1-yl)propane-1-sulfonamide (PubChem CID 58995146) has the molecular formula C9H17N3O4S and a molecular weight of 263.32 g/mol. Its IUPAC name is 3-(3,5,5-trimethyl-2,4-dioxoimidazolidin-1-yl)propane-1-sulfonamide.
| Compound Name | 3-(3,5,5-trimethyl-2,4-dioxoimidazolidin-1-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 58995146 |
| Molecular Formula | C9H17N3O4S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3-(3,5,5-trimethyl-2,4-dioxoimidazolidin-1-yl)propane-1-sulfonamide |
| SMILES | CN1C(=O)N(CCCS(N)(=O)=O)C(C)(C)C1=O |
| InChI | InChI=1S/C9H17N3O4S/c1-9(2)7(13)11(3)8(14)12(9)5-4-6-17(10,15)16/h4-6H2,1-3H3,(H2,10,15,16) |
| InChIKey | ADAQURFJJZTXEP-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|